3,5-DICHLORO-2-HYDROXYBENZENESULFONYL CHLORIDE structure
|
Common Name | 3,5-DICHLORO-2-HYDROXYBENZENESULFONYL CHLORIDE | ||
|---|---|---|---|---|
| CAS Number | 23378-88-3 | Molecular Weight | 261.51000 | |
| Density | 1.761g/cm3 | Boiling Point | 359ºC at 760 mmHg | |
| Molecular Formula | C6H3Cl3O3S | Melting Point | 78-84ºC | |
| MSDS | Chinese USA | Flash Point | 170.9ºC | |
| Symbol |
GHS05 |
Signal Word | Danger | |
Use of 3,5-DICHLORO-2-HYDROXYBENZENESULFONYL CHLORIDE |
| Name | 3,5-dichloro-2-hydroxybenzenesulfonyl chloride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.761g/cm3 |
|---|---|
| Boiling Point | 359ºC at 760 mmHg |
| Melting Point | 78-84ºC |
| Molecular Formula | C6H3Cl3O3S |
| Molecular Weight | 261.51000 |
| Flash Point | 170.9ºC |
| Exact Mass | 259.88700 |
| PSA | 62.75000 |
| LogP | 3.70730 |
| Appearance of Characters | Powder | Light beige to light brown |
| Vapour Pressure | 1.18E-05mmHg at 25°C |
| Index of Refraction | 1.611 |
| InChIKey | KXFQRJNVGBIDHA-UHFFFAOYSA-N |
| SMILES | O=S(=O)(Cl)c1cc(Cl)cc(Cl)c1O |
| Storage condition | Store below +30°C. |
| Water Solubility | Hydrolyzes in water. |
| Symbol |
GHS05 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H314 |
| Precautionary Statements | P280-P305 + P351 + P338-P310 |
| Personal Protective Equipment | Eyeshields;Faceshields;full-face particle respirator type N100 (US);Gloves;respirator cartridge type N100 (US);type P1 (EN143) respirator filter;type P3 (EN 143) respirator cartridges |
| Hazard Codes | C:Corrosive; |
| Risk Phrases | R34 |
| Safety Phrases | S24/25 |
| RIDADR | UN 3261 8/PG 2 |
| WGK Germany | 3 |
| Packaging Group | II |
| HS Code | 2908999090 |
|
~78%
3,5-DICHLORO-2-... CAS#:23378-88-3 |
| Literature: Cremlyn, R. J.; Swinbourne, F. J.; Fitzgerald, P.; Godfrey, N.; Hedges, P.; et al. Indian Journal of Chemistry, Section B: Organic Chemistry Including Medicinal Chemistry, 1984 , vol. 23, # 10 p. 962 - 968 |
| HS Code | 2908999090 |
|---|---|
| Summary | 2908999090 halogenated, sulphonated, nitrated or nitrosated derivatives of phenols or phenol-alcohols。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
|
A one-step determination of serum 5'-nucleotidase using a centrifugal analyzer.
Clin. Chim. Acta 119(3) , 275-84, (1982) We describe a one-step kinetic method for the determination of 5'-nucleotidase (EC 3.1.3.5). Inosine is formed by the hydrolysis of inosine 5'-monophosphate which is catalyzed by seric 5'-nucleotidase... |
|
|
Enantioselective addition of diethylzinc to benzaldehyde catalyzed by chiral titanate complexes with helical ligands. Guo C, et al.
Tetrahedron 53(12) , 4145-58, (1997)
|
| 3,5-Cl2-2-(OH)C6H2SO2Cl |
| 3,5-dichloro-2-hydroxy-benzenesulfonyl chloride |
| Benzenesulfonyl chloride,3,5-dichloro-2-hydroxy |
| 2,4-Dichlorophenol-6-sulfonyl chloride |
| 3,5-dichloro-6-hydroxy benzenesulphonyl chloride |
| 2-hydroxy-3,5-dichlorobenzenesulfonyl chloride |
| EINECS 245-619-9 |
| 3,5-dichloro-2-hydroxybenzene-1-sulfonyl chloride |
| MFCD00007432 |
| 3,5-dichloro-2-hydroxy-benzenesulfonic acid chloride |