2,2-dithiobis(4,6-dichlorophenol) structure
|
Common Name | 2,2-dithiobis(4,6-dichlorophenol) | ||
|---|---|---|---|---|
| CAS Number | 57548-07-9 | Molecular Weight | 388.11700 | |
| Density | 1.79g/cm3 | Boiling Point | 447ºC at 760mmHg | |
| Molecular Formula | C12H6Cl4O2S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 224.1ºC | |
| Name | 2,4-dichloro-6-[(3,5-dichloro-2-hydroxyphenyl)disulfanyl]phenol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.79g/cm3 |
|---|---|
| Boiling Point | 447ºC at 760mmHg |
| Molecular Formula | C12H6Cl4O2S2 |
| Molecular Weight | 388.11700 |
| Flash Point | 224.1ºC |
| Exact Mass | 385.85600 |
| PSA | 91.06000 |
| LogP | 6.51080 |
| Index of Refraction | 1.768 |
| InChIKey | YVALZDKTCRMZLQ-UHFFFAOYSA-N |
| SMILES | Oc1c(Cl)cc(Cl)cc1SSc1cc(Cl)cc(Cl)c1O |
|
~93%
2,2-dithiobis(4... CAS#:57548-07-9 |
| Literature: Jafarpour, Maasoumeh; Rezaeifard, Abdolreza; Heidari, Mahdieh Phosphorus, Sulfur and Silicon and the Related Elements, 2011 , vol. 186, # 7 p. 1470 - 1482 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| Dtbdcp |