Boc-bipiperidine-ethynylbenzoic acid
Modify Date: 2025-08-26 12:07:56
Boc-bipiperidine-ethynylbenzoic acid structure
|
Common Name | Boc-bipiperidine-ethynylbenzoic acid | ||
|---|---|---|---|---|
| CAS Number | 2308497-81-4 | Molecular Weight | 412.52 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C24H32N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Boc-bipiperidine-ethynylbenzoic acidBoc-bipiperidine-ethynylbenzoic acid is an Alkyl/ether-based PROTAC linker can be used in the synthesis of ARD-61[1]. |
| Name | Boc-bipiperidine-ethynylbenzoic acid |
|---|
| Description | Boc-bipiperidine-ethynylbenzoic acid is an Alkyl/ether-based PROTAC linker can be used in the synthesis of ARD-61[1]. |
|---|---|
| Related Catalog | |
| Target |
Alkyl/ether |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1]. |
| References |
| Molecular Formula | C24H32N2O4 |
|---|---|
| Molecular Weight | 412.52 |
| InChIKey | CKVUNMOAVOFHIQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC(N2CCC(C#Cc3ccc(C(=O)O)cc3)CC2)CC1 |
| Storage condition | 2-8°C |