Sodium 1-heptanesulfonate structure
|
Common Name | Sodium 1-heptanesulfonate | ||
|---|---|---|---|---|
| CAS Number | 22767-50-6 | Molecular Weight | 202.247 | |
| Density | 1.017 g/cm | Boiling Point | N/A | |
| Molecular Formula | C7H15NaO3S | Melting Point | >300 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Name | sodium,heptane-1-sulfonate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.017 g/cm |
|---|---|
| Melting Point | >300 °C(lit.) |
| Molecular Formula | C7H15NaO3S |
| Molecular Weight | 202.247 |
| Exact Mass | 202.063965 |
| PSA | 65.58000 |
| LogP | 2.58280 |
| InChIKey | REFMEZARFCPESH-UHFFFAOYSA-M |
| SMILES | CCCCCCCS(=O)(=O)[O-].[Na+] |
| Water Solubility | soluble |
| Personal Protective Equipment | Eyeshields;Gloves |
|---|---|
| Hazard Codes | Xi:Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S37/39-S26-S36/37 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 29041000 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2904100000 |
|---|---|
| Summary | 2904100000 derivatives containing only sulpho groups, their salts and ethyl esters。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
|
Organic-aqueous crossover coating process for the desmopressin orally disintegrating microparticles.
Drug Dev. Ind. Pharm. 41(2) , 292-9, (2015) The purpose of the present study was to prepare desmopressin orally disintegrating microparticles (ODMs) using organic-aqueous crossover coating process which featured an organic sub-coating followed ... |
|
|
Distribution of serotonin 5-HT1A-binding sites in the brainstem and the hypothalamus, and their roles in 5-HT-induced sleep and ingestive behaviors in rock pigeons (Columba livia).
Behav. Brain Res. 295 , 45-63, (2015) Serotonin 1A receptors (5-HT1ARs), which are widely distributed in the mammalian brain, participate in cognitive and emotional functions. In birds, 5-HT1ARs are expressed in prosencephalic areas invol... |
|
|
Freeze-drying of HI-6-loaded recombinant human serum albumin nanoparticles for improved storage stability.
Eur. J. Pharm. Biopharm. 88(2) , 510-7, (2014) Severe intoxications with organophosphates require the immediate administration of atropine in combination with acetyl cholinesterase (AChE) reactivators such as HI-6. Although this therapy regimen en... |
| Sodium 1-heptanesulfonate |
| sodium heptane-1-sulfonate |
| 1-Heptanesulfonic Acid Sodium Salt |
| 1-Heptanesulfonic acid, sodium salt (1:1) |
| 1-Heptanesulfonic acid sodium salt monohydrate |
| sodium n-heptanesulfonate |
| Heptylsulfonic Acid Sodium Salt |
| sodium heptane-sulphonate |
| n-heptanesulfonic acid sodium salt |
| EINECS 245-210-5 |
| 1-Heptanesulfonic acid sodium |
| sodium heptane-1-sulphonate |
| 1-heptanesulfonic acid,sodium salt |
| Sodium 1-heptanesulfonate monohydrate |
| MFCD00007543 |