L-Hexanoylcarnitine structure
|
Common Name | L-Hexanoylcarnitine | ||
|---|---|---|---|---|
| CAS Number | 22671-29-0 | Molecular Weight | 259.34200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H25NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of L-HexanoylcarnitineL-Hexanoylcarnitine is an acylcarnitine and is found to be associated with celiac disease. |
| Name | O-hexanoyl-L-carnitine |
|---|
| Description | L-Hexanoylcarnitine is an acylcarnitine and is found to be associated with celiac disease. |
|---|---|
| Related Catalog | |
| Target |
Human Endogenous Metabolite |
| References |
| Molecular Formula | C13H25NO4 |
|---|---|
| Molecular Weight | 259.34200 |
| Exact Mass | 259.17800 |
| PSA | 66.43000 |
| LogP | 0.32470 |
| InChIKey | VVPRQWTYSNDTEA-LLVKDONJSA-N |
| SMILES | CCCCCC(=O)OC(CC(=O)[O-])C[N+](C)(C)C |
| Storage condition | 2-8℃ |