2,4'-dichloro-4-nitrodiphenyl ether
Modify Date: 2025-08-26 12:44:43
2,4'-dichloro-4-nitrodiphenyl ether structure
|
Common Name | 2,4'-dichloro-4-nitrodiphenyl ether | ||
|---|---|---|---|---|
| CAS Number | 22544-07-6 | Molecular Weight | 284.09500 | |
| Density | 1.451g/cm3 | Boiling Point | 351.6ºC at 760mmHg | |
| Molecular Formula | C12H7Cl2NO3 | Melting Point | 105-109 °C(lit.) | |
| MSDS | N/A | Flash Point | 166.4ºC | |
| Name | 2-chloro-1-(4-chlorophenoxy)-4-nitrobenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.451g/cm3 |
|---|---|
| Boiling Point | 351.6ºC at 760mmHg |
| Melting Point | 105-109 °C(lit.) |
| Molecular Formula | C12H7Cl2NO3 |
| Molecular Weight | 284.09500 |
| Flash Point | 166.4ºC |
| Exact Mass | 282.98000 |
| PSA | 55.05000 |
| LogP | 5.21710 |
| Vapour Pressure | 8.26E-05mmHg at 25°C |
| Index of Refraction | 1.623 |
| InChIKey | RTCVXHVOOYCYNA-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(Oc2ccc(Cl)cc2)c(Cl)c1 |
| Safety Phrases | S22-S24/25 |
|---|---|
| WGK Germany | 3 |
| HS Code | 2909309090 |
|
~%
2,4'-dichloro-4... CAS#:22544-07-6 |
| Literature: Syntex (U.S.A.) Inc. Patent: US5034410 A1, 1991 ; |
|
~%
2,4'-dichloro-4... CAS#:22544-07-6 |
| Literature: Bayer Aktiengesellschaft Patent: US5382686 A1, 1995 ; |
| HS Code | 2909309090 |
|---|---|
| Summary | 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| MFCD00204156 |
| EINECS 245-071-0 |
| 4-(4'-chloro)phenoxy-3-chloronitrobenzene |
| (2-Chlor-4-nitro-phenyl)-(4-chlor-phenyl)-aether |
| 2,4'-dichloro-4-nitrodiphenyl ether |
| (2-chloro-4-nitro-phenyl)-(4-chloro-phenyl)-ether |