m-nitrobenzophenone structure
|
Common Name | m-nitrobenzophenone | ||
|---|---|---|---|---|
| CAS Number | 2243-80-3 | Molecular Weight | 227.215 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 377.9±25.0 °C at 760 mmHg | |
| Molecular Formula | C13H9NO3 | Melting Point | 92-94 °C | |
| MSDS | Chinese USA | Flash Point | 181.9±16.0 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 3-Nitrobenzophenone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 377.9±25.0 °C at 760 mmHg |
| Melting Point | 92-94 °C |
| Molecular Formula | C13H9NO3 |
| Molecular Weight | 227.215 |
| Flash Point | 181.9±16.0 °C |
| Exact Mass | 227.058243 |
| PSA | 62.89000 |
| LogP | 3.01 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.615 |
| InChIKey | MFYLRNKOXORIPK-UHFFFAOYSA-N |
| SMILES | O=C(c1ccccc1)c1cccc([N+](=O)[O-])c1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | 36/37/38 |
| Safety Phrases | S37/39-S26 |
| RIDADR | NONH for all modes of transport |
| HS Code | 2914700090 |
| Precursor 9 | |
|---|---|
| DownStream 9 | |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
|
A comparative study on the photo-induced arylation of β-dicarbonyl compounds by arylazosulfides and its use in the synthesis of methyl labeled 2-arylpropionic acids. Tona M, et al.
Tetrahedron 50(27) , 8117-26, (1994)
|
|
|
Acetophenone and benzophenone derivatives as catalysts in photodegradation of PE and PP films. Manangan T, et al.
Adv. Mater. Res. 93 , 284-87, (2010)
|
| EINECS 218-819-9 |
| (3-Nitrophenyl)(phenyl)methanone |
| m-nitrobenzophenone |
| Methanone, (3-nitrophenyl)phenyl- |
| (3-nitrophenyl)-phenylmethanone |
| MFCD00007257 |