Tinengotinib structure
|
Common Name | Tinengotinib | ||
|---|---|---|---|---|
| CAS Number | 2230490-29-4 | Molecular Weight | 394.86 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H19ClN6O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of TinengotinibTinengotinib is the modulator of one or more protein kinases such as Aurora kinase and VEGFR kinase. Tinengotinib has the potential for the research of these kinase abnormalities diseases mediated, especially cancer-related diseases (extracted from patent WO2018108079A1)[1]. |
| Name | Tinengotinib |
|---|
| Description | Tinengotinib is the modulator of one or more protein kinases such as Aurora kinase and VEGFR kinase. Tinengotinib has the potential for the research of these kinase abnormalities diseases mediated, especially cancer-related diseases (extracted from patent WO2018108079A1)[1]. |
|---|---|
| Related Catalog | |
| Target |
Aurora and VEGFR[1] |
| References |
| Molecular Formula | C20H19ClN6O |
|---|---|
| Molecular Weight | 394.86 |
| InChIKey | DQFCVOOFMXEPOC-UHFFFAOYSA-N |
| SMILES | Cc1[nH]nc2c1N=C(c1ccccc1Cl)c1cnc(N3CCOCC3)cc1N2 |