| Name |
N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-3-[4-(difluoromethyl)-2,3-dimethyl-6-oxo-2,6-dihydro-7H-pyrazolo[3,4-b]pyridin-7-yl]propanamide
|
| Molecular Formula |
C21H21F2N5O2S
|
| Molecular Weight |
445.5
|
| Smiles |
Cc1c2c(C(F)F)cc(=O)n(CCC(=O)Nc3sc4c(c3C#N)CCCC4)c2nn1C
|
Cc1c2c(C(F)F)cc(=O)n(CCC(=O)Nc3sc4c(c3C#N)CCCC4)c2nn1C
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.