Methyl 4-methoxybenzoylacetate structure
|
Common Name | Methyl 4-methoxybenzoylacetate | ||
|---|---|---|---|---|
| CAS Number | 22027-50-5 | Molecular Weight | 208.211 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 315.4±17.0 °C at 760 mmHg | |
| Molecular Formula | C11H12O4 | Melting Point | 40-42ºC | |
| MSDS | N/A | Flash Point | 138.0±21.0 °C | |
| Name | methyl 3-(4-methoxyphenyl)-3-oxopropanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 315.4±17.0 °C at 760 mmHg |
| Melting Point | 40-42ºC |
| Molecular Formula | C11H12O4 |
| Molecular Weight | 208.211 |
| Flash Point | 138.0±21.0 °C |
| Exact Mass | 208.073563 |
| PSA | 52.60000 |
| LogP | 1.41 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.507 |
| InChIKey | VXXOASOINNOPGR-UHFFFAOYSA-N |
| SMILES | COC(=O)CC(=O)c1ccc(OC)cc1 |
| HS Code | 2918990090 |
|---|
| Precursor 10 | |
|---|---|
| DownStream 10 | |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 3-(4-Methoxyphenyl)-3-oxo-propionic acid methylester |
| Methyl 3-(4-methoxyphenyl)-3-oxopropanoate |
| Methyl 3-(4-methoxyphenyl)-3-oxo-propionate |
| EINECS 244-732-0 |
| Benzenepropanoic acid, 4-methoxy-β-oxo-, methyl ester |
| Methyl 4-methoxybenzoylacetate |
| MFCD01082033 |
| 3-(4-Methoxyphenyl)-3-oxo-propionicacidmethylester |
| methyl p-methoxybenzoylacetate |