PNU112455A hydrochloride structure
|
Common Name | PNU112455A hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 21886-12-4 | Molecular Weight | 301.75300 | |
| Density | 1.532g/cm3 | Boiling Point | 568.6ºC at 760 mmHg | |
| Molecular Formula | C10H12ClN5O2S | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 297.7ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
Use of PNU112455A hydrochloridePNU112455A hydrochloride is an ATP-competitive CDK2 and CDK5 inhibitor. PNU112455A hydrochloride binds to the ATP site of CDK2 and CDK5 with Kms of 3.6 and 3.2 μM, respectively [1]. |
| Name | 4-[(6-aminopyrimidin-4-yl)amino]benzenesulfonamide |
|---|---|
| Synonym | More Synonyms |
| Description | PNU112455A hydrochloride is an ATP-competitive CDK2 and CDK5 inhibitor. PNU112455A hydrochloride binds to the ATP site of CDK2 and CDK5 with Kms of 3.6 and 3.2 μM, respectively [1]. |
|---|---|
| Related Catalog | |
| Target |
CDK2:3.6 μM (Km) CDK5:3.2 μM (Km) |
| References |
| Density | 1.532g/cm3 |
|---|---|
| Boiling Point | 568.6ºC at 760 mmHg |
| Molecular Formula | C10H12ClN5O2S |
| Molecular Weight | 301.75300 |
| Flash Point | 297.7ºC |
| Exact Mass | 301.04000 |
| PSA | 132.37000 |
| LogP | 3.68710 |
| Vapour Pressure | 6.04E-13mmHg at 25°C |
| Index of Refraction | 1.697 |
| InChIKey | XBXQRCJKDCEQBS-UHFFFAOYSA-N |
| SMILES | Cl.Nc1cc(Nc2ccc(S(N)(=O)=O)cc2)ncn1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Hazard Codes | Xi |
| Risk Phrases | 36/37/38 |
| RIDADR | NONH for all modes of transport |
| HS Code | 2935009090 |
| HS Code | 2935009090 |
|---|---|
| Summary | 2935009090 other sulphonamides VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:35.0% |
| 4-[(6-amino-4-pyrimidinyl)amino]-benzenesulfonamide hydrochloride |