BDP 581/591 maleimide structure
|
Common Name | BDP 581/591 maleimide | ||
|---|---|---|---|---|
| CAS Number | 2183473-29-0 | Molecular Weight | 514.33 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C28H25BF2N4O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of BDP 581/591 maleimideBDP 581/591 maleimide is a linker of the BDP 581/591 dye. It has a long fluorescence lifetime and can be used for fluorescence polarization assays. The maleimide group can react with thiol groups to form thioester bonds between pH 6.5 to 7.5, for the labeling of sulfhydryl groups of proteins and peptides. |
| Name | BDP 581/591 maleimide |
|---|
| Description | BDP 581/591 maleimide is a linker of the BDP 581/591 dye. It has a long fluorescence lifetime and can be used for fluorescence polarization assays. The maleimide group can react with thiol groups to form thioester bonds between pH 6.5 to 7.5, for the labeling of sulfhydryl groups of proteins and peptides. |
|---|---|
| Related Catalog |
| Molecular Formula | C28H25BF2N4O3 |
|---|---|
| Molecular Weight | 514.33 |
| InChIKey | YPTVPBNWROLSKT-KBXRYBNXSA-N |
| SMILES | O=C(CCc1ccc2n1[B-](F)(F)[N+]1=C(C=CC=Cc3ccccc3)C=CC1=C2)NCCN1C(=O)C=CC1=O |