BDP 581/591 amine hydrochloride
Modify Date: 2025-11-27 15:53:57
BDP 581/591 amine hydrochloride structure
|
Common Name | BDP 581/591 amine hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 2183472-97-9 | Molecular Weight | 526.86 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C28H34BClF2N4O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of BDP 581/591 amine hydrochlorideBDP 581/591 amine hydrochloride is a BODIPY dye linker. BDP 581/591 is a universal, photostable fluorophore. The addition of the amine group allows for the compound to react with carboxylic acids, activated NHS esters and other carbonyl groups[1]. |
| Name | BDP 581/591 amine hydrochloride |
|---|
| Description | BDP 581/591 amine hydrochloride is a BODIPY dye linker. BDP 581/591 is a universal, photostable fluorophore. The addition of the amine group allows for the compound to react with carboxylic acids, activated NHS esters and other carbonyl groups[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C28H34BClF2N4O |
|---|---|
| Molecular Weight | 526.86 |
| InChIKey | WRSSTWIVIHVQBR-FSRDMIDLSA-N |
| SMILES | [Cl-].[NH3+]CCCCCCNC(=O)CCc1ccc2n1[B-](F)(F)[N+]1=C(C=CC=Cc3ccccc3)C=CC1=C2 |