4,7-Dichloro-2,8-dimethylquinoline structure
|
Common Name | 4,7-Dichloro-2,8-dimethylquinoline | ||
|---|---|---|---|---|
| CAS Number | 21728-15-4 | Molecular Weight | 226.102 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 317.1±37.0 °C at 760 mmHg | |
| Molecular Formula | C11H9Cl2N | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 175.0±12.1 °C | |
| Symbol |
GHS05, GHS06 |
Signal Word | Danger | |
| Name | 4,7-Dichloro-2,8-dimethylquinoline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 317.1±37.0 °C at 760 mmHg |
| Molecular Formula | C11H9Cl2N |
| Molecular Weight | 226.102 |
| Flash Point | 175.0±12.1 °C |
| Exact Mass | 225.011200 |
| PSA | 12.89000 |
| LogP | 4.38 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.630 |
| InChIKey | FGFQQASKLBXKQZ-UHFFFAOYSA-N |
| SMILES | Cc1cc(Cl)c2ccc(Cl)c(C)c2n1 |
| Symbol |
GHS05, GHS06 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H301-H318-H413 |
| Precautionary Statements | P280-P301 + P310-P305 + P351 + P338 |
| RIDADR | UN 2811 6.1 / PGIII |
| HS Code | 2933499090 |
|
~%
4,7-Dichloro-2,... CAS#:21728-15-4 |
| Literature: Medicinal Chemistry Research, , vol. 21, # 10 p. 3073 - 3079,7 |
|
~%
4,7-Dichloro-2,... CAS#:21728-15-4 |
| Literature: Medicinal Chemistry Research, , vol. 21, # 10 p. 3073 - 3079,7 |
|
~%
4,7-Dichloro-2,... CAS#:21728-15-4 |
| Literature: Medicinal Chemistry Research, , vol. 21, # 10 p. 3073 - 3079,7 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4,7-Dichloro-2,8-dimethylquinoline |
| Quinoline, 4,7-dichloro-2,8-dimethyl- |