4,6-dichloro-2,8-dimethylquinoline structure
|
Common Name | 4,6-dichloro-2,8-dimethylquinoline | ||
|---|---|---|---|---|
| CAS Number | 21629-51-6 | Molecular Weight | 226.10200 | |
| Density | 1.305g/cm3 | Boiling Point | 310.9ºC at 760mmHg | |
| Molecular Formula | C11H9Cl2N | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 170.9ºC | |
| Name | 4,6-dichloro-2,8-dimethylquinoline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.305g/cm3 |
|---|---|
| Boiling Point | 310.9ºC at 760mmHg |
| Molecular Formula | C11H9Cl2N |
| Molecular Weight | 226.10200 |
| Flash Point | 170.9ºC |
| Exact Mass | 225.01100 |
| PSA | 12.89000 |
| LogP | 4.15840 |
| Vapour Pressure | 0.00106mmHg at 25°C |
| Index of Refraction | 1.629 |
| InChIKey | CPJUQQYVCLNEHM-UHFFFAOYSA-N |
| SMILES | Cc1cc(Cl)c2cc(Cl)cc(C)c2n1 |
| HS Code | 2933499090 |
|---|
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4,6-dichloro-2,8-dimethyl-quinoline |
| 4,6-Dichloro-8-methylquinaldine |