Azido-PEG23-amine structure
|
Common Name | Azido-PEG23-amine | ||
|---|---|---|---|---|
| CAS Number | 2172677-19-7 | Molecular Weight | 1099.30 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C48H98N4O23 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Azido-PEG23-amineAzido-PEG23-amine is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
| Name | Azido-PEG23-amine |
|---|
| Description | Azido-PEG23-amine is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
|---|---|
| Related Catalog | |
| Target |
PEGs |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1]. |
| References |
| Molecular Formula | C48H98N4O23 |
|---|---|
| Molecular Weight | 1099.30 |
| InChIKey | MUYDHNADYGGZNC-UHFFFAOYSA-N |
| SMILES | [N-]=[N+]=NCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCN |