4-[(4-Methylpiperazine-1-)sulfonyl]aniline structure
|
Common Name | 4-[(4-Methylpiperazine-1-)sulfonyl]aniline | ||
|---|---|---|---|---|
| CAS Number | 21623-68-7 | Molecular Weight | 255.33700 | |
| Density | 1.288g/cm3 | Boiling Point | 424.1ºC at 760mmHg | |
| Molecular Formula | C11H17N3O2S | Melting Point | 228-229°C | |
| MSDS | N/A | Flash Point | 210.3ºC | |
| Name | 4-[(4-Methyl-1-piperazinyl)sulfonyl]aniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.288g/cm3 |
|---|---|
| Boiling Point | 424.1ºC at 760mmHg |
| Melting Point | 228-229°C |
| Molecular Formula | C11H17N3O2S |
| Molecular Weight | 255.33700 |
| Flash Point | 210.3ºC |
| Exact Mass | 255.10400 |
| PSA | 75.02000 |
| LogP | 1.74270 |
| Vapour Pressure | 2.12E-07mmHg at 25°C |
| InChIKey | YEKKOBZSGMPECJ-UHFFFAOYSA-N |
| SMILES | CN1CCN(S(=O)(=O)c2ccc(N)cc2)CC1 |
| Storage condition | 2-8°C |
| Hazard Codes | Xi: Irritant; |
|---|---|
| HS Code | 2935009090 |
|
~53%
4-[(4-Methylpip... CAS#:21623-68-7 |
| Literature: King Pharmaceuticuals Research and Development, Inc. Patent: US6921825 B2, 2005 ; |
|
~%
4-[(4-Methylpip... CAS#:21623-68-7 |
| Literature: Bulletin des Societes Chimiques Belges, , vol. 59, p. 228,234 |
|
~%
4-[(4-Methylpip... CAS#:21623-68-7 |
| Literature: Bioorganic and Medicinal Chemistry, , vol. 22, # 8 p. 2416 - 2426 |
|
~%
4-[(4-Methylpip... CAS#:21623-68-7 |
| Literature: Bulletin des Societes Chimiques Belges, , vol. 59, p. 228,234 |
|
~%
4-[(4-Methylpip... CAS#:21623-68-7 |
| Literature: Bulletin des Societes Chimiques Belges, , vol. 59, p. 228,234 |
| HS Code | 2935009090 |
|---|---|
| Summary | 2935009090 other sulphonamides VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:35.0% |
| MFCD03050283 |
| 4-(4-methylpiperazin-1-yl)sulfonylaniline |
| 4-(4-Methyl-piperazine-1-sulfonyl)-phenylamine |
| 4-[(4-Methylpiperazine-1-)sulfonyl]aniline |