1,1,1,2,2-Pentafluoro-6,6-dimethyl-3,5-heptanedione
Modify Date: 2025-09-12 19:52:30
1,1,1,2,2-Pentafluoro-6,6-dimethyl-3,5-heptanedione structure
|
Common Name | 1,1,1,2,2-Pentafluoro-6,6-dimethyl-3,5-heptanedione | ||
|---|---|---|---|---|
| CAS Number | 2145-68-8 | Molecular Weight | 246.17400 | |
| Density | 1.238g/cm3 | Boiling Point | 65ºC 30mm | |
| Molecular Formula | C9H11F5O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 69.6ºC | |
| Name | 1,1,1,2,2-Pentafluoro-6,6-dimethyl-3,5-heptanedione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.238g/cm3 |
|---|---|
| Boiling Point | 65ºC 30mm |
| Molecular Formula | C9H11F5O2 |
| Molecular Weight | 246.17400 |
| Flash Point | 69.6ºC |
| Exact Mass | 246.06800 |
| PSA | 34.14000 |
| LogP | 2.75840 |
| Vapour Pressure | 0.581mmHg at 25°C |
| Index of Refraction | 1.366 |
| InChIKey | FTTQCEGWFGHNDU-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)CC(=O)C(F)(F)C(F)(F)F |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | 26-36 |
| HS Code | 2914700090 |
|
~%
1,1,1,2,2-Penta... CAS#:2145-68-8 |
| Literature: Moore,R.A.; Levine,R. Journal of Organic Chemistry, 1964 , vol. 29, p. 1439 - 1444 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| 1,1,1,2,2-pentafluoro-6,6-dimethylheptane-3,5-dione |