PF 06551600 malonate structure
|
Common Name | PF 06551600 malonate | ||
|---|---|---|---|---|
| CAS Number | 2140301-97-7 | Molecular Weight | 389.40572 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H23N5O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of PF 06551600 malonatePF-06651600 malonate is a novel potent, selective JAK3 inhibitor with IC50 of 0.346 nM, displays >1,000-fold selectivity over JAK1 and JAK2. |
| Name | 1-((2S,5R)-5-((7H-pyrrolo[2,3-d]pyrimidin-4-yl)amino)-2-methylpiperidin-1-yl)prop-2-en-1-one malonate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C18H23N5O5 |
|---|---|
| Molecular Weight | 389.40572 |
| InChIKey | QMPMPSGDPRHZCG-VZXYPILPSA-N |
| SMILES | C=CC(=O)N1CC(Nc2ncnc3[nH]ccc23)CCC1C.O=C(O)CC(=O)O |
| PF-06651600 malonate |