Pomalidomide-PEG1-C2-COOH
Modify Date: 2025-08-23 19:29:26
Pomalidomide-PEG1-C2-COOH structure
|
Common Name | Pomalidomide-PEG1-C2-COOH | ||
|---|---|---|---|---|
| CAS Number | 2139348-60-8 | Molecular Weight | 389.359 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 726.2±60.0 °C at 760 mmHg | |
| Molecular Formula | C18H19N3O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 393.0±32.9 °C | |
Use of Pomalidomide-PEG1-C2-COOHPomalidomide-PEG1-C2-COOH is a synthesized E3 ligase ligand-linker conjugate that incorporates the Pomalidomide based cereblon ligand and 1-unit PEG linker used in PROTAC technology. |
| Name | 3-(2-{[2-(2,6-Dioxo-3-piperidinyl)-1,3-dioxo-2,3-dihydro-1H-isoindol-4-yl]amino}ethoxy)propanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 726.2±60.0 °C at 760 mmHg |
| Molecular Formula | C18H19N3O7 |
| Molecular Weight | 389.359 |
| Flash Point | 393.0±32.9 °C |
| Exact Mass | 389.122314 |
| LogP | -0.68 |
| Vapour Pressure | 0.0±2.5 mmHg at 25°C |
| Index of Refraction | 1.647 |
| InChIKey | GXCGXOBFROXMLV-UHFFFAOYSA-N |
| SMILES | O=C(O)CCOCCNc1cccc2c1C(=O)N(C1CCC(=O)NC1=O)C2=O |
| 3-(2-{[2-(2,6-Dioxo-3-piperidinyl)-1,3-dioxo-2,3-dihydro-1H-isoindol-4-yl]amino}ethoxy)propanoic acid |
| Propanoic acid, 3-[2-[[2-(2,6-dioxo-3-piperidinyl)-2,3-dihydro-1,3-dioxo-1H-isoindol-4-yl]amino]ethoxy]- |