Chlorthal structure
|
Common Name | Chlorthal | ||
|---|---|---|---|---|
| CAS Number | 2136-79-0 | Molecular Weight | 303.911 | |
| Density | 1.9±0.1 g/cm3 | Boiling Point | 425.2±45.0 °C at 760 mmHg | |
| Molecular Formula | C8H2Cl4O4 | Melting Point | 239-242°C | |
| MSDS | N/A | Flash Point | 210.9±28.7 °C | |
Use of ChlorthalChlorthal is an insecticide |
| Name | chlorthal |
|---|---|
| Synonym | More Synonyms |
| Density | 1.9±0.1 g/cm3 |
|---|---|
| Boiling Point | 425.2±45.0 °C at 760 mmHg |
| Melting Point | 239-242°C |
| Molecular Formula | C8H2Cl4O4 |
| Molecular Weight | 303.911 |
| Flash Point | 210.9±28.7 °C |
| Exact Mass | 301.870728 |
| PSA | 74.60000 |
| LogP | 3.85 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.657 |
| InChIKey | KZCBXHSWMMIEQU-UHFFFAOYSA-N |
| SMILES | O=C(O)c1c(Cl)c(Cl)c(C(=O)O)c(Cl)c1Cl |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Hazard Codes | C: Corrosive; |
|---|---|
| RTECS | CZ4400000 |
| HS Code | 2917399013 |
|
~96%
Chlorthal CAS#:2136-79-0 |
| Literature: SDS Biotech K.K. Patent: US2001/25121 A1, 2001 ; |
|
~95%
Chlorthal CAS#:2136-79-0 |
| Literature: SDS Biotech K.K. Patent: US2001/25121 A1, 2001 ; |
|
~89%
Chlorthal CAS#:2136-79-0 |
| Literature: Boogaerts, Ine I. F.; Nolan, Steven P. Journal of the American Chemical Society, 2010 , vol. 132, # 26 p. 8858 - 8859 |
|
~9%
Chlorthal CAS#:2136-79-0
Detail
|
| Literature: Collection of Czechoslovak Chemical Communications, , vol. 65, # 6 p. 862 - 880 |
|
~%
Chlorthal CAS#:2136-79-0 |
| Literature: Chemische Berichte, , vol. 29, p. 1633 |
|
~%
Chlorthal CAS#:2136-79-0 |
| Literature: J. Appl. Chem. USSR (Engl. Transl.), , vol. 56, # 1 p. 237 - 238,229 - 230 |
|
~%
Chlorthal CAS#:2136-79-0 |
| Literature: Chemische Berichte, , vol. 29, p. 1633 |
|
~%
Detail
|
| Literature: Chemische Berichte, , vol. 29, p. 1633 |
| HS Code | 2917399013 |
|---|---|
| Summary | 2917399013 2,3,5,6-tetrachloroterephthalic acid。supervision conditions:s(import or export registration certificate for pesticides)。VAT:17.0%。tax rebate rate:9.0%。MFN tarrif:6.5%。general tariff:30.0% |
| Tetrachloroterephthalicacid |
| Chlorthal |
| DCPA (USA) |
| MFCD00013974 |
| tetrachlorobenzene-1,4-dicarboxylic acid |
| Perchloroterephthalic acid |
| DCPA |
| 2,3,5,6-tetrachlorobenzene-1,4-dicarboxylic acid |
| 2,3,5,6-Tetrachloroterephthalic acid |
| Tetrachloroterephthalic Acid, Pract. |
| tetrachloroterephthalic acid |
| 2,3,5,6-tetrachloro-1,4-benzenedicarboxylic acid |
| Terephthalic acid,tetrachloro |
| Caswell No. 833A |
| 1,4-Benzenedicarboxylic acid, 2,3,5,6-tetrachloro- |
| 2,3,5,6-Tetrachloro-1,4-benzenecarboxylic acid |