CP-481715 structure
|
Common Name | CP-481715 | ||
|---|---|---|---|---|
| CAS Number | 212790-31-3 | Molecular Weight | 482.54700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C26H31FN4O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of CP-481715CP-481715 is a potent and selective CCR1 antagonist with Ki of 9.2 nM and IC50 of 74 nM, lacks intrinsic agonist activity and . |
| Name | N-[(2S,3S,5R)-5-carbamoyl-1-(3-fluorophenyl)-3,8-dihydroxy-8-methylnonan-2-yl]quinoxaline-2-carboxamide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C26H31FN4O4 |
|---|---|
| Molecular Weight | 482.54700 |
| Exact Mass | 482.23300 |
| PSA | 142.91000 |
| LogP | 4.23810 |
| InChIKey | YEQJVHQCUDMXFG-FHZYATBESA-N |
| SMILES | CC(C)(O)CCC(CC(O)C(Cc1cccc(F)c1)NC(=O)c1cnc2ccccc2n1)C(N)=O |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| cp-481,715 |