2-[(2-chloroacetyl)amino]-3-phenylprop-2-enoic acid structure
|
Common Name | 2-[(2-chloroacetyl)amino]-3-phenylprop-2-enoic acid | ||
|---|---|---|---|---|
| CAS Number | 21195-40-4 | Molecular Weight | 239.65500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H10ClNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-[(2-chloroacetyl)amino]-3-phenylprop-2-enoic acid |
|---|
| Molecular Formula | C11H10ClNO3 |
|---|---|
| Molecular Weight | 239.65500 |
| Exact Mass | 239.03500 |
| PSA | 69.89000 |
| LogP | 2.30740 |
| InChIKey | YJROAHSMJWAZBY-UHFFFAOYSA-N |
| SMILES | O=C(CCl)NC(=Cc1ccccc1)C(=O)O |
|
~%
2-[(2-chloroace... CAS#:21195-40-4 |
| Literature: Kurita,H. et al. Bulletin of the Chemical Society of Japan, 1968 , vol. 41, # 11 p. 2758 - 2762 |
|
~%
2-[(2-chloroace... CAS#:21195-40-4 |
| Literature: Kurita,H. et al. Bulletin of the Chemical Society of Japan, 1968 , vol. 41, # 11 p. 2758 - 2762 |
| Precursor 1 | |
|---|---|
| DownStream 2 | |