N-(azide-PEG3)-N'-(m-PEG4)-Benzothiazole Cy5 structure
|
Common Name | N-(azide-PEG3)-N'-(m-PEG4)-Benzothiazole Cy5 | ||
|---|---|---|---|---|
| CAS Number | 2107273-88-9 | Molecular Weight | 772.39 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C39H54ClN5O7S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of N-(azide-PEG3)-N'-(m-PEG4)-Benzothiazole Cy5N-(azide-PEG3)-N'-(m-PEG4)-Benzothiazole Cy5 is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
| Name | N-(azide-PEG3)-N'-(m-PEG4)-Benzothiazole Cy5 |
|---|
| Description | N-(azide-PEG3)-N'-(m-PEG4)-Benzothiazole Cy5 is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
|---|---|
| Related Catalog | |
| Target |
PEGs |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1]. |
| References |
| Molecular Formula | C39H54ClN5O7S |
|---|---|
| Molecular Weight | 772.39 |
| InChIKey | MHHLVWQRJSAVFX-UHFFFAOYSA-M |
| SMILES | COCCOCCOCCOCC[n+]1c(C=CC=CC=C2N(CCOCCOCCOCCN=[N+]=[N-])c3ccccc3C2(C)C)sc2ccccc21.[Cl-] |
| Hazard Codes | Xi |
|---|