N-(m-PEG4)-N'-(PEG2-NHS ester)-Cy5
Modify Date: 2025-08-20 08:46:45
N-(m-PEG4)-N'-(PEG2-NHS ester)-Cy5 structure
|
Common Name | N-(m-PEG4)-N'-(PEG2-NHS ester)-Cy5 | ||
|---|---|---|---|---|
| CAS Number | 2107273-28-7 | Molecular Weight | 838.43 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C45H60ClN3O10 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of N-(m-PEG4)-N'-(PEG2-NHS ester)-Cy5N-(m-PEG4)-N'-(PEG2-NHS ester)-Cy5 is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
| Name | N-(m-PEG4)-N'-(PEG2-NHS ester)-Cy5 |
|---|
| Description | N-(m-PEG4)-N'-(PEG2-NHS ester)-Cy5 is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
|---|---|
| Related Catalog | |
| Target |
PEGs |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1]. |
| References |
| Molecular Formula | C45H60ClN3O10 |
|---|---|
| Molecular Weight | 838.43 |
| InChIKey | QBKOBGOQDYZADQ-UHFFFAOYSA-M |
| SMILES | COCCOCCOCCOCC[N+]1=C(C=CC=CC=C2N(CCOCCOCCC(=O)ON3C(=O)CCC3=O)c3ccccc3C2(C)C)C(C)(C)c2ccccc21.[Cl-] |
| Hazard Codes | Xi |
|---|