n(alpha)-(2 4-dinitro-5-fluorophenyl)- structure
|
Common Name | n(alpha)-(2 4-dinitro-5-fluorophenyl)- | ||
|---|---|---|---|---|
| CAS Number | 210529-62-7 | Molecular Weight | 300.24300 | |
| Density | 1.469g/cm3 | Boiling Point | 537.5ºC at 760 mmHg | |
| Molecular Formula | C11H13FN4O5 | Melting Point | 173-177ºC | |
| MSDS | Chinese USA | Flash Point | 278.9ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
Use of n(alpha)-(2 4-dinitro-5-fluorophenyl)-Nα-(2,4-Dinitro-5-fluorophenyl)-D-valinamide is a valine derivative[1]. |
| Name | (2R)-2-(5-fluoro-2,4-dinitroanilino)-3-methylbutanamide |
|---|
| Description | Nα-(2,4-Dinitro-5-fluorophenyl)-D-valinamide is a valine derivative[1]. |
|---|---|
| Related Catalog | |
| In Vitro | Amino acids and amino acid derivatives have been commercially used as ergogenic supplements. They influence the secretion of anabolic hormones, supply of fuel during exercise, mental performance during stress related tasks and prevent exercise induced muscle damage. They are recognized to be beneficial as ergogenic dietary substances[1]. |
| References |
| Density | 1.469g/cm3 |
|---|---|
| Boiling Point | 537.5ºC at 760 mmHg |
| Melting Point | 173-177ºC |
| Molecular Formula | C11H13FN4O5 |
| Molecular Weight | 300.24300 |
| Flash Point | 278.9ºC |
| Exact Mass | 300.08700 |
| PSA | 146.76000 |
| LogP | 3.38360 |
| Vapour Pressure | 1.26E-11mmHg at 25°C |
| Index of Refraction | 1.611 |
| InChIKey | ZTFFRKNPAXXEBL-SNVBAGLBSA-N |
| SMILES | CC(C)C(Nc1cc(F)c([N+](=O)[O-])cc1[N+](=O)[O-])C(N)=O |
| Storage condition | 2-8°C |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi |
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26-36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
|
Linear and cyclic peptides from the entomopathogenic bacterium Xenorhabdus nematophilus.
J. Nat. Prod. 71(6) , 1074-7, (2008) Three new peptides, xenortides A and B and xenematide, were isolated from a culture of the nematode-associated entomopathogenic bacterium Xenorhabdus nematophilus. Their structures were elucidated usi... |