Obtucarbamate B
Modify Date: 2025-08-20 12:49:32
Obtucarbamate B structure
|
Common Name | Obtucarbamate B | ||
|---|---|---|---|---|
| CAS Number | 20913-18-2 | Molecular Weight | 238.240 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 266.6±40.0 °C at 760 mmHg | |
| Molecular Formula | C11H14N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 115.0±27.3 °C | |
Use of Obtucarbamate BObtucarbamate B is a carbamate derivative, that can be isolated from the South China Sea gorgonian coral Melitodes squamata Nutting[1]. |
| Name | Obtucarbamate B |
|---|---|
| Synonym | More Synonyms |
| Description | Obtucarbamate B is a carbamate derivative, that can be isolated from the South China Sea gorgonian coral Melitodes squamata Nutting[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 266.6±40.0 °C at 760 mmHg |
| Molecular Formula | C11H14N2O4 |
| Molecular Weight | 238.240 |
| Flash Point | 115.0±27.3 °C |
| Exact Mass | 238.095352 |
| PSA | 76.66000 |
| LogP | 2.33 |
| Vapour Pressure | 0.0±0.5 mmHg at 25°C |
| Index of Refraction | 1.600 |
| InChIKey | JNNLWOJZIPJIQG-UHFFFAOYSA-N |
| SMILES | COC(=O)Nc1cccc(NC(=O)OC)c1C |
| Hazard Codes | Xi |
|---|
| Precursor 0 | |
|---|---|
| DownStream 1 | |
CAS#:91-08-7| Dimethyl (2-methyl-1,3-phenylene)biscarbamate |
| Carbamic acid, N,N'-(2-methyl-1,3-phenylene)bis-, dimethyl ester |