Trimethyl Aconitate
Modify Date: 2025-08-25 19:54:13
Trimethyl Aconitate structure
|
Common Name | Trimethyl Aconitate | ||
|---|---|---|---|---|
| CAS Number | 20820-77-3 | Molecular Weight | 216.18800 | |
| Density | 1.194g/cm3 | Boiling Point | 270.5ºC at 760 mmHg | |
| Molecular Formula | C9H12O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 116.1ºC | |
| Name | Trimethyl Aconitate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.194g/cm3 |
|---|---|
| Boiling Point | 270.5ºC at 760 mmHg |
| Molecular Formula | C9H12O6 |
| Molecular Weight | 216.18800 |
| Flash Point | 116.1ºC |
| Exact Mass | 216.06300 |
| PSA | 78.90000 |
| Vapour Pressure | 0.00682mmHg at 25°C |
| Index of Refraction | 1.453 |
| InChIKey | DZAIBGWGBBQGPZ-XQRVVYSFSA-N |
| SMILES | COC(=O)C=C(CC(=O)OC)C(=O)OC |
| HS Code | 2917190090 |
|---|
|
~0%
Detail
|
| Literature: EGIS GYOGYSZERGYAR RT. Patent: WO2004/89867 A2, 2004 ; Location in patent: Page 20-26 ; |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2917190090 |
|---|---|
| Summary | 2917190090 acyclic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Trimethyl aconitate |