TRIMETHYL[(3-METHYLPHENYL)ETHYNYL]SILANE structure
|
Common Name | TRIMETHYL[(3-METHYLPHENYL)ETHYNYL]SILANE | ||
|---|---|---|---|---|
| CAS Number | 40230-90-8 | Molecular Weight | 188.34100 | |
| Density | 0.9 | Boiling Point | 230ºC | |
| Molecular Formula | C12H16Si | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 88ºC | |
| Name | trimethyl-[2-(3-methylphenyl)ethynyl]silane |
|---|---|
| Synonym | More Synonyms |
| Density | 0.9 |
|---|---|
| Boiling Point | 230ºC |
| Molecular Formula | C12H16Si |
| Molecular Weight | 188.34100 |
| Flash Point | 88ºC |
| Exact Mass | 188.10200 |
| LogP | 3.22390 |
| InChIKey | CPCHVDAIWZRYGB-UHFFFAOYSA-N |
| SMILES | Cc1cccc(C#C[Si](C)(C)C)c1 |
| HS Code | 2931900090 |
|---|
|
~94%
TRIMETHYL[(3-ME... CAS#:40230-90-8 |
| Literature: Xu, Caixia; Du, Weiyuan; Zeng, Yi; Dai, Bin; Guo, Hao Organic Letters, 2014 , vol. 16, # 3 p. 948 - 951 |
|
~%
TRIMETHYL[(3-ME... CAS#:40230-90-8 |
| Literature: Musso, David L; Clarke, Morris J; Kelley, James L; Boswell, G Evan; Chen, Grace Organic and biomolecular chemistry, 2003 , vol. 1, # 3 p. 498 - 506 |
|
~%
TRIMETHYL[(3-ME... CAS#:40230-90-8 |
| Literature: Atienza; Mateo; de Frutos; Echavarren Organic letters, 2001 , vol. 3, # 2 p. 153 - 155 |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| meta-tolyl-2-(trimethylsilyl)acetylene |
| 4-(m-tolylethynyl)pyridine |
| A6730 |
| trimethyl[(3-methylphenyl)ethynyl]silane |
| (2-(3-methylphenyl)ethynyl)trimethylsilane |
| 3-Methylphenyl(trimethylsilyl)ethyne |
| trimethyl(2-m-tolylethynyl)silane |
| 3-(trimethylsilylethynyl)toluene |