1-nitrooxybutan-2-yl nitrate structure
|
Common Name | 1-nitrooxybutan-2-yl nitrate | ||
|---|---|---|---|---|
| CAS Number | 20820-41-1 | Molecular Weight | 180.11600 | |
| Density | 1.352g/cm3 | Boiling Point | 224.6ºC at 760 mmHg | |
| Molecular Formula | C4H8N2O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 101.3ºC | |
| Name | 1-nitrooxybutan-2-yl nitrate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.352g/cm3 |
|---|---|
| Boiling Point | 224.6ºC at 760 mmHg |
| Molecular Formula | C4H8N2O6 |
| Molecular Weight | 180.11600 |
| Flash Point | 101.3ºC |
| Exact Mass | 180.03800 |
| PSA | 110.10000 |
| LogP | 1.22800 |
| Vapour Pressure | 0.135mmHg at 25°C |
| Index of Refraction | 1.453 |
| InChIKey | CTISQZXTUUHJNC-UHFFFAOYSA-N |
| SMILES | CCC(CO[N+](=O)[O-])O[N+](=O)[O-] |
| HS Code | 2920909090 |
|---|
|
~94%
1-nitrooxybutan... CAS#:20820-41-1 |
| Literature: Golding, Peter; Millar, Ross W.; Paul, Norman C.; Richards, David H. Tetrahedron, 1993 , vol. 49, # 32 p. 7037 - 7050 |
|
~%
1-nitrooxybutan... CAS#:20820-41-1 |
| Literature: Golding, Peter; Millar, Ross W.; Paul, Norman C.; Richards, David H. Tetrahedron, 1993 , vol. 49, # 32 p. 7037 - 7050 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2920909090 |
|---|---|
| Summary | 2920909090 esters of other inorganic acids of non-metals (excluding esters of hydrogen halides) and their salts; their halogenated, sulphonated, nitrated or nitrosated derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 1,2-bis-nitryloxy-butane |
| 1,2-Bis-nitryloxy-butan |
| butane-1,2-diyl dinitrate |
| butane-1,2-diol dinitrate |
| 1.2-Butylenglykol-dinitrat |