butane-1,2,3-triyl trinitrate
Modify Date: 2025-08-25 15:28:24
butane-1,2,3-triyl trinitrate structure
|
Common Name | butane-1,2,3-triyl trinitrate | ||
|---|---|---|---|---|
| CAS Number | 84002-64-2 | Molecular Weight | 241.11300 | |
| Density | 1.578g/cm3 | Boiling Point | 300.7ºC at 760 mmHg | |
| Molecular Formula | C4H7N3O9 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 139.5ºC | |
| Name | 1,3-dinitrooxybutan-2-yl nitrate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.578g/cm3 |
|---|---|
| Boiling Point | 300.7ºC at 760 mmHg |
| Molecular Formula | C4H7N3O9 |
| Molecular Weight | 241.11300 |
| Flash Point | 139.5ºC |
| Exact Mass | 241.01800 |
| PSA | 165.15000 |
| LogP | 0.93800 |
| Index of Refraction | 1.485 |
| InChIKey | GIFRMMSPDQZIHL-UHFFFAOYSA-N |
| SMILES | CC(O[N+](=O)[O-])C(CO[N+](=O)[O-])O[N+](=O)[O-] |
| HS Code | 2920909090 |
|---|
|
~%
butane-1,2,3-tr... CAS#:84002-64-2 |
| Literature: Shell Devel.Co. Patent: US2139364 , 1937 ; |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2920909090 |
|---|---|
| Summary | 2920909090 esters of other inorganic acids of non-metals (excluding esters of hydrogen halides) and their salts; their halogenated, sulphonated, nitrated or nitrosated derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| EINECS 281-654-6 |
| Butane-1,2,3-triyl trinitrate |
| 1,2,3-tris-nitryloxy-butane |