butane, 1,2,3,4-tetrachlorohexafluoro-
Modify Date: 2025-08-26 12:27:18
butane, 1,2,3,4-tetrachlorohexafluoro- structure
|
Common Name | butane, 1,2,3,4-tetrachlorohexafluoro- | ||
|---|---|---|---|---|
| CAS Number | 375-45-1 | Molecular Weight | 303.845 | |
| Density | 1.8±0.1 g/cm3 | Boiling Point | 131.5±8.0 °C at 760 mmHg | |
| Molecular Formula | C4Cl4F6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 47.9±11.9 °C | |
| Name | 1,2,3,4-tetrachloro-1,1,2,3,4,4-hexafluorobutane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.8±0.1 g/cm3 |
|---|---|
| Boiling Point | 131.5±8.0 °C at 760 mmHg |
| Molecular Formula | C4Cl4F6 |
| Molecular Weight | 303.845 |
| Flash Point | 47.9±11.9 °C |
| Exact Mass | 301.865845 |
| LogP | 6.37 |
| Vapour Pressure | 11.4±0.2 mmHg at 25°C |
| Index of Refraction | 1.388 |
| InChIKey | IRHYACQPDDXBCB-UHFFFAOYSA-N |
| SMILES | FC(F)(Cl)C(F)(Cl)C(F)(Cl)C(F)(F)Cl |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26-36 |
| HS Code | 2903799090 |
| HS Code | 2903799090 |
|---|---|
| Summary | 2903799090 halogenated derivatives of acyclic hydrocarbons containing two or more different halogens。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| EINECS 248-847-7 |
| Butane,1,2,3,4-tetrachlorohexafluoro |
| Butane, 1,2,3,4-tetrachloro-1,1,2,3,4,4-hexafluoro- |
| 1,2,3,4-tetrachloro-1,1,2,3,4,4-hexafluoro-butane |
| butane, 1,2,3,4-tetrachlorohexafluoro- |
| 1,2,3,4-tetrachlorohexafluoro-butane |
| 1,2,3,4-Tetrachloro-1,1,2,3,4,4-hexafluorobutane |
| 1,2,3,4-tetrachloroperfluorobutane |
| 1,2,3,4-Tetrachlor-hexafluor-butan |