(1-oxo-1-phenylpropan-2-yl) nitrate
Modify Date: 2025-09-21 14:09:18
(1-oxo-1-phenylpropan-2-yl) nitrate structure
|
Common Name | (1-oxo-1-phenylpropan-2-yl) nitrate | ||
|---|---|---|---|---|
| CAS Number | 60434-74-4 | Molecular Weight | 195.17200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H9NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (1-oxo-1-phenylpropan-2-yl) nitrate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C9H9NO4 |
|---|---|
| Molecular Weight | 195.17200 |
| Exact Mass | 195.05300 |
| PSA | 72.12000 |
| LogP | 1.98930 |
| InChIKey | VJWUGFSVFUCQLC-UHFFFAOYSA-N |
| SMILES | CC(O[N+](=O)[O-])C(=O)c1ccccc1 |
|
~70%
(1-oxo-1-phenyl... CAS#:60434-74-4 |
| Literature: Miles; Lho; Chittawong; Payne Journal of Organic Chemistry, 1990 , vol. 55, # 13 p. 4034 - 4036 |
|
~%
(1-oxo-1-phenyl... CAS#:60434-74-4 |
| Literature: Emmons; Freeman Journal of the American Chemical Society, 1955 , vol. 77, p. 4415 |
|
~%
(1-oxo-1-phenyl... CAS#:60434-74-4 |
| Literature: Ahlbrecht,H.; Hagena,D. Chemische Berichte, 1976 , vol. 109, p. 2345 - 2350 |
| 1-methyl-2-oxo-2-phenylethyl nitrate |
| 2-Nitryloxy-1-phenyl-propan-1-on |
| Propiophenon-2-nitrat |
| 1-Propanone,2-(nitrooxy)-1-phenyl |
| 2-nitryloxy-1-phenyl-propan-1-one |