4-BBPB maleate
Modify Date: 2025-08-26 23:56:52
4-BBPB maleate structure
|
Common Name | 4-BBPB maleate | ||
|---|---|---|---|---|
| CAS Number | 207572-62-1 | Molecular Weight | 409.51800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C25H31NO4 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS07, GHS09 |
Signal Word | Warning | |
Use of 4-BBPB maleate4-BBPB maleate is a highly potent agonist of σ1 receptor with Ki of 0.8 nM. |
| Name | 4-PPBP maleate,4-Phenyl-1-(4-phenylbutyl)piperidinemaleate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C25H31NO4 |
|---|---|
| Molecular Weight | 409.51800 |
| Exact Mass | 409.22500 |
| PSA | 77.84000 |
| LogP | 4.53860 |
| InChIKey | OASPNIMFGJVLES-BTJKTKAUSA-N |
| SMILES | O=C(O)C=CC(=O)O.c1ccc(CCCCN2CCC(c3ccccc3)CC2)cc1 |
| Symbol |
GHS07, GHS09 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302-H315-H319-H335-H400 |
| Precautionary Statements | P261-P273-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xn,N |
| RIDADR | UN 3077 9/PG 3 |
| HS Code | 2925290090 |
| HS Code | 2925290090 |
|---|---|
| Summary | 2925290090 other imines and their derivatives; salts thereof。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| PPBP maleate |
| 4-phenyl-1-(4-phenylbutyl)-piperidine maleate 4-PPBP maleate |
| 4-PPBP MALEATE |