GENZ-882706(Raceme) structure
|
Common Name | GENZ-882706(Raceme) | ||
|---|---|---|---|---|
| CAS Number | 2070861-46-8 | Molecular Weight | 455.51 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C26H25N5O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of GENZ-882706(Raceme)GENZ-882706(Raceme) is the racemate of GENZ-882706. |
| Name | GENZ-882706(Raceme) |
|---|
| Description | GENZ-882706(Raceme) is the racemate of GENZ-882706. |
|---|---|
| Related Catalog |
| Molecular Formula | C26H25N5O3 |
|---|---|
| Molecular Weight | 455.51 |
| InChIKey | DRBFONOVLOXKJM-UHFFFAOYSA-N |
| SMILES | COc1ccc(C2COc3cc(Cn4cnc5cc(C#CC(C)(C)N)cnc54)ccc3O2)cn1 |