Coumarin 466
Modify Date: 2025-08-26 14:06:09
Coumarin 466 structure
|
Common Name | Coumarin 466 | ||
|---|---|---|---|---|
| CAS Number | 20571-42-0 | Molecular Weight | 217.26400 | |
| Density | 1.155g/cm3 | Boiling Point | 384.2ºC at 760 mmHg | |
| Molecular Formula | C13H15NO2 | Melting Point | 89 °C | |
| MSDS | Chinese USA | Flash Point | 154.6ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 7-(diethylamino)chromen-2-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.155g/cm3 |
|---|---|
| Boiling Point | 384.2ºC at 760 mmHg |
| Melting Point | 89 °C |
| Molecular Formula | C13H15NO2 |
| Molecular Weight | 217.26400 |
| Flash Point | 154.6ºC |
| Exact Mass | 217.11000 |
| PSA | 33.45000 |
| LogP | 2.63920 |
| Vapour Pressure | 4.17E-06mmHg at 25°C |
| Index of Refraction | 1.588 |
| InChIKey | QXAMGWKESXGGNV-UHFFFAOYSA-N |
| SMILES | CCN(CC)c1ccc2ccc(=O)oc2c1 |
| HS Code | 2932209090 |
|---|---|
| Summary | 2932209090. other lactones. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|
Disc-shaped polyoxyethylene glycol glycerides gel nanoparticles as novel protein delivery vehicles.
Int. J. Pharm. 496 , 1015-25, (2015) Disc-shaped nanoparticles with high aspect ratios have been reported to show preferential cellular uptake in vitro by mammalian cells. However, engineering and producing such disc-shaped nanoparticles... |
| Coumarine,7-diethylamino |
| Coumarin 466 |
| coumarin 446 |
| Coumarin 110 |
| 2H-1-Benzopyran-2-one,7-(diethylamino) |
| 7-(Diethylamino)coumarin |
| 7-NEt2-coumarin |
| 7-diethylamino-coumarin |
| EINECS 243-888-7 |
| MFCD00232946 |