Lansiumarin C
Modify Date: 2025-08-31 20:52:02
Lansiumarin C structure
|
Common Name | Lansiumarin C | ||
|---|---|---|---|---|
| CAS Number | 205115-75-9 | Molecular Weight | 354.396 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 544.4±50.0 °C at 760 mmHg | |
| Molecular Formula | C21H22O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 283.0±30.1 °C | |
Use of Lansiumarin CLansiumarin C, a lansiumarin, can be isolated from the branches of Clausena lansium (Rutaceae)[1]. |
| Name | 9-{[(2E)-6-Hydroxy-3,7-dimethyl-2,7-octadien-1-yl]oxy}-7H-furo[3, 2-g]chromen-7-one |
|---|---|
| Synonym | More Synonyms |
| Description | Lansiumarin C, a lansiumarin, can be isolated from the branches of Clausena lansium (Rutaceae)[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 544.4±50.0 °C at 760 mmHg |
| Molecular Formula | C21H22O5 |
| Molecular Weight | 354.396 |
| Flash Point | 283.0±30.1 °C |
| Exact Mass | 354.146729 |
| PSA | 72.81000 |
| LogP | 4.38 |
| Vapour Pressure | 0.0±1.5 mmHg at 25°C |
| Index of Refraction | 1.593 |
| InChIKey | DBHLROWQWPSCQG-KRWDZBQOSA-N |
| SMILES | C=C(C)C(O)CCC(C)=CCOc1c2occc2cc2ccc(=O)oc12 |
| Hazard Codes | Xi |
|---|
| 9-{[(2E)-6-Hydroxy-3,7-dimethyl-2,7-octadien-1-yl]oxy}-7H-furo[3,2-g]chromen-7-one |
| 7H-Furo[3,2-g][1]benzopyran-7-one, 9-[[(2E)-6-hydroxy-3,7-dimethyl-2,7-octadien-1-yl]oxy]- |