4,4'-PCB structure
|
Common Name | 4,4'-PCB | ||
|---|---|---|---|---|
| CAS Number | 2050-68-2 | Molecular Weight | 223.098 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 318.0±17.0 °C at 760 mmHg | |
| Molecular Formula | C12H8Cl2 | Melting Point | 288℃ | |
| MSDS | N/A | Flash Point | 145.2±14.5 °C | |
| Symbol |
GHS02, GHS07, GHS08, GHS09 |
Signal Word | Danger | |
| Name | 4,4'-dichlorobiphenyl |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 318.0±17.0 °C at 760 mmHg |
| Melting Point | 288℃ |
| Molecular Formula | C12H8Cl2 |
| Molecular Weight | 223.098 |
| Flash Point | 145.2±14.5 °C |
| Exact Mass | 222.000305 |
| LogP | 5.12 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.594 |
| InChIKey | YTBRNEUEFCNVHC-UHFFFAOYSA-N |
| SMILES | Clc1ccc(-c2ccc(Cl)cc2)cc1 |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
MUTATION DATA
|
| Symbol |
GHS02, GHS07, GHS08, GHS09 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H225-H304-H315-H336-H373-H410 |
| Precautionary Statements | P210-P261-P273-P301 + P310-P331-P501 |
| Hazard Codes | F: Flammable;Xi: Irritant; |
| Risk Phrases | R11 |
| Safety Phrases | 16-26-33-36 |
| RIDADR | UN 2315 |
| RTECS | DV3912500 |
| Packaging Group | II |
| Hazard Class | 9 |
| HS Code | 2903999010 |
| HS Code | 2903999010 |
|---|---|
| Summary | 2903999010 2,3,3',4,5,6-hexachloro-1,1'-biphenyl。supervision conditions:89(articles on the list of prohibited export goods,articles on the list of prohibited import goods)。VAT:17.0%。tax rebate rate:9.0%。MFN tarrif:5.5%。general tariff:30.0% |
|
Microbial dehalogenation of 4,4'-dichlorobiphenyl under anaerobic conditions.
Sci. Total Environ. 101(3) , 263-8, (1991) Anaerobic cultures containing 4,4'-dichlorobiphenyl (4,4'CB) were inoculated with various environmental samples. The degradation of the substrate was followed by gas chromatographic analysis. Three of... |
|
|
Possible molecular targets of halogenated aromatic hydrocarbons in neuronal cells.
Biochem. Biophys. Res. Commun. 280(5) , 1372-7, (2001) Halogenated aromatic hydrocarbon including polychlorinated biphenyls (PCBs) are persistent and bioaccumulative environmental toxicants. Although health effects associated with exposure to these chemic... |
|
|
The effect of chlorine substitution on the disposition of polychlorinated biphenyls following dermal administration.
Toxicol. Appl. Pharmacol. 216(1) , 157-67, (2006) The fate of selected polychlorobiphenyls (PCBs) was investigated following single dermal administration (0.4 mg/kg) to determine the effects of chlorine content and position on the disposition of PCBs... |
| Biphenyl,4,4'-dichloro |
| p,p'-dichlorobiphenyl |
| 4,4'-Dichloro-1,1'-biphenyl |
| Biphenyl, 4,4'-dichloro- |
| 1,1'-Biphenyl, 4,4'-dichloro- |
| PCB 15 |
| p,p-Dcbp |
| 4,4'-PCB |
| MFCD00013641 |
| 4,4'-Dichlorobiphenyl |
| PCB No 15 |
| 1,1'-Biphenyl,4,4'-dichloro |
| EINECS 218-095-4 |
| 4,4'-Dichloro-biphenyl |
| 1-chloro-4-(4-chlorophenyl)benzene |
| 4.4'-Dichlorobiphenyl |