2,4-Dibromo-1-naphthol structure
|
Common Name | 2,4-Dibromo-1-naphthol | ||
|---|---|---|---|---|
| CAS Number | 2050-49-9 | Molecular Weight | 301.96200 | |
| Density | 1.956g/cm3 | Boiling Point | 357ºC at 760mmHg | |
| Molecular Formula | C10H6Br2O | Melting Point | 107ºC | |
| MSDS | N/A | Flash Point | 169.7ºC | |
| Name | 2,4-dibromonaphthalen-1-ol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.956g/cm3 |
|---|---|
| Boiling Point | 357ºC at 760mmHg |
| Melting Point | 107ºC |
| Molecular Formula | C10H6Br2O |
| Molecular Weight | 301.96200 |
| Flash Point | 169.7ºC |
| Exact Mass | 299.87900 |
| PSA | 20.23000 |
| LogP | 4.07040 |
| Vapour Pressure | 1.37E-05mmHg at 25°C |
| Index of Refraction | 1.726 |
| Risk Phrases | 36/37/38 |
|---|---|
| Safety Phrases | 26-36/37/39 |
| HS Code | 2908199090 |
| Precursor 9 | |
|---|---|
| DownStream 9 | |
| HS Code | 2908199090 |
|---|---|
| Summary | HS: 2908199090. derivatives of polyphenols or phenol-alcohols containing only halogen substituents and their salts. VAT:17.0%. tax rebate rate:9.0%. supervision conditions:None. MFN tariff:5.5%. general tariff:30.0% |
| 2,4-DIBROMO-1-NAPHTHOL |
| 2,4-dibromo-1-naphthalenol |
| 2,4-Dibrom-[1]naphthol |
| ACMC-1CDOF |
| PSGUDVJPEWTBRM-UHFFFAOYSA |
| InChI=1/C10H6Br2O/c11-8-5-9(12)10(13)7-4-2-1-3-6(7)8/h1-5,13H |
| 2,4-Dibromonaphthalen-1-ol |
| 2.4-Dibrom-1-hydroxy-naphthalin |
| 1-Naphthalenol,2,4-dibromo |
| 2,4-dibromo-[1]naphthol |
| 2,3-DISTERAOYL-SN-GLYCERO-1-PHOSPHO-L-SERINE (MONOSODIUM SALT |