Anthirrinoside
Modify Date: 2025-08-23 19:23:15
Anthirrinoside structure
|
Common Name | Anthirrinoside | ||
|---|---|---|---|---|
| CAS Number | 20486-27-5 | Molecular Weight | 362.33 | |
| Density | 1.7±0.1 g/cm3 | Boiling Point | 648.3±55.0 °C at 760 mmHg | |
| Molecular Formula | C15H22O10 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 345.9±31.5 °C | |
Use of AnthirrinosideProcumbide (compound 11) is a flavone glucoside. Procumbide can be isolated from Andrographis paniculata[1]. |
| Name | Procumbide |
|---|---|
| Synonym | More Synonyms |
| Description | Procumbide (compound 11) is a flavone glucoside. Procumbide can be isolated from Andrographis paniculata[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.7±0.1 g/cm3 |
|---|---|
| Boiling Point | 648.3±55.0 °C at 760 mmHg |
| Molecular Formula | C15H22O10 |
| Molecular Weight | 362.33 |
| Flash Point | 345.9±31.5 °C |
| Exact Mass | 362.121307 |
| PSA | 161.60000 |
| LogP | -3.39 |
| Vapour Pressure | 0.0±4.4 mmHg at 25°C |
| Index of Refraction | 1.680 |
| InChIKey | UBAIOTDKPLIEDD-NTRJNKTHSA-N |
| SMILES | CC12OC1C(O)C1(O)C=COC(OC3OC(CO)C(O)C(O)C3O)C12 |
| Hazard Codes | Xi |
|---|
| Anthirrinoside |
| β-D-Glucopyranoside, (1aR,1bS,2S,5aS,6S,6aS)-1a,1b,2,5a,6,6a-hexahydro-5a,6-dihydroxy-1a-methyloxireno[4,5]cyclopenta[1,2-c]pyran-2-yl |
| (1aR,1bS,2S,5aS,6S,6aS)-5a,6-Dihydroxy-1a-methyl-1a,1b,2,5a,6,6a-hexahydrooxireno[4,5]cyclopenta[1,2-c]pyran-2-yl β-D-glucopyranoside |
| β-D-Glucopyranoside, (1aR,1bS,2S,5aS,6R,6aS)-1a,1b,2,5a,6,6a-hexahydro-5a,6-dihydroxy-1a-methyloxireno[4,5]cyclopenta[1,2-c]pyran-2-yl |
| Procumbide |
| (1aR,1bS,2S,5aS,6R,6aS)-5a,6-Dihydroxy-1a-methyl-1a,1b,2,5a,6,6a-hexahydrooxireno[4,5]cyclopenta[1,2-c]pyran-2-yl β-D-glucopyranoside |
| Antirrhinoside |