DOTA-(Tyr3)-Octreotide acetate salt
Modify Date: 2025-08-23 10:03:38
DOTA-(Tyr3)-Octreotide acetate salt structure
|
Common Name | DOTA-(Tyr3)-Octreotide acetate salt | ||
|---|---|---|---|---|
| CAS Number | 204318-14-9 | Molecular Weight | 1421.64000 | |
| Density | 1.46g/cm3 | Boiling Point | 1723.7ºC at 760 mmHg | |
| Molecular Formula | C65H92N14O18S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 996.2ºC | |
Use of DOTA-(Tyr3)-Octreotide acetate saltEdotreotide is a somatostatin analogue. Edotreotide bound to various radionuclides, has the potential for the research and diagnosis of certain types of cancer[1]. |
| Name | dota-d-phe-cys-tyr-d-trp-lys-thr-cys-thr-ol (disulfide bridge: 2-7) |
|---|
| Description | Edotreotide is a somatostatin analogue. Edotreotide bound to various radionuclides, has the potential for the research and diagnosis of certain types of cancer[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.46g/cm3 |
|---|---|
| Boiling Point | 1723.7ºC at 760 mmHg |
| Molecular Formula | C65H92N14O18S2 |
| Molecular Weight | 1421.64000 |
| Flash Point | 996.2ºC |
| Exact Mass | 1420.62000 |
| PSA | 530.99000 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.684 |
| InChIKey | RZHKDBRREKOZEW-GWHZJBTMSA-N |
| SMILES | CC(O)C(CO)NC(=O)C1CSSCC(NC(=O)C(Cc2ccccc2)NC(=O)CN2CCN(CC(=O)O)CCN(CC(=O)O)CCN(CC(=O)O)CC2)C(=O)NC(Cc2ccc(O)cc2)C(=O)NC(Cc2c[nH]c3ccccc23)C(=O)NC(CCCCN)C(=O)NC(C(C)O)C(=O)N1 |