2',3',4',5',6'-pentamethylacetophenone structure
|
Common Name | 2',3',4',5',6'-pentamethylacetophenone | ||
|---|---|---|---|---|
| CAS Number | 2040-01-9 | Molecular Weight | 190.28100 | |
| Density | 0.94g/cm3 | Boiling Point | 311.4ºC at 760mmHg | |
| Molecular Formula | C13H18O | Melting Point | 84-86 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 131ºC | |
| Name | 1-(2,3,4,5,6-pentamethylphenyl)ethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 0.94g/cm3 |
|---|---|
| Boiling Point | 311.4ºC at 760mmHg |
| Melting Point | 84-86 °C(lit.) |
| Molecular Formula | C13H18O |
| Molecular Weight | 190.28100 |
| Flash Point | 131ºC |
| Exact Mass | 190.13600 |
| PSA | 17.07000 |
| LogP | 3.43120 |
| Vapour Pressure | 0.000564mmHg at 25°C |
| Index of Refraction | 1.508 |
| InChIKey | CTTYWXDVWGKHKJ-UHFFFAOYSA-N |
| SMILES | CC(=O)c1c(C)c(C)c(C)c(C)c1C |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Safety Phrases | S22-S24/25 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2914399090 |
|
~93%
2',3',4',5',6'-... CAS#:2040-01-9 |
| Literature: Kiprof, Paul; Li, Jun; Renish, Catherine L.; Kalombo, Eddie K.; Young Jr., Victor G. Journal of Organometallic Chemistry, 2001 , vol. 620, # 1-2 p. 113 - 118 |
|
~67%
2',3',4',5',6'-... CAS#:2040-01-9 |
| Literature: Fuerstner, Alois; Voigtlaender, David; Schrader, Wolfgang; Giebel, Dirk; Reetz, Manfred T. Organic Letters, 2001 , vol. 3, # 3 p. 417 - 420 |
| HS Code | 2914399090 |
|---|---|
| Summary | 2914399090. other aromatic ketones without other oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:5.5%. General tariff:30.0% |
| Pentamethylacetophenone |
| 1-pentamethylphenyl-ethanone |
| 2′,3′,4′,5′,6′-Pentamethylacetophenone |
| EINECS 218-033-6 |
| 1-Pentamethylphenyl-aethanon |
| 2,3,4,5,6-pentamethylacetophenone |
| MFCD00014986 |
| Acetylpentamethylbenzene |