METHIOCARB structure
|
Common Name | METHIOCARB | ||
|---|---|---|---|---|
| CAS Number | 2032-65-7 | Molecular Weight | 225.307 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 341.3±52.0 °C at 760 mmHg | |
| Molecular Formula | C11H15NO2S | Melting Point | 119°C | |
| MSDS | Chinese USA | Flash Point | 160.2±30.7 °C | |
| Symbol |
GHS06, GHS09 |
Signal Word | Danger | |
Use of METHIOCARBMethiocarb is a carbamate pesticide which is used as a bird repellent, insecticide, acaricide and molluscicide. Methiocarb inhibits reversibly acetylcholinesterase activity resulting in a cholinergic stimulation making methiocarb a potent neurotoxin. |
| Name | methiocarb |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 341.3±52.0 °C at 760 mmHg |
| Melting Point | 119°C |
| Molecular Formula | C11H15NO2S |
| Molecular Weight | 225.307 |
| Flash Point | 160.2±30.7 °C |
| Exact Mass | 225.082352 |
| PSA | 63.63000 |
| LogP | 3.55 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.541 |
| InChIKey | YFBPRJGDJKVWAH-UHFFFAOYSA-N |
| SMILES | CNC(=O)Oc1cc(C)c(SC)c(C)c1 |
| Water Solubility | Insoluble |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Symbol |
GHS06, GHS09 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H300-H410 |
| Precautionary Statements | P264-P273-P301 + P310-P501 |
| Personal Protective Equipment | Eyeshields;Faceshields;Gloves;type P2 (EN 143) respirator cartridges |
| Hazard Codes | T:Toxic;N:Dangerousfortheenvironment; |
| Risk Phrases | R25;R50/53 |
| Safety Phrases | S22-S37-S45-S60-S61 |
| RIDADR | UN 2811/2757 |
| RTECS | FC5775000 |
| Packaging Group | II |
| Hazard Class | 6.1(a) |
| HS Code | 2930909052 |
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| HS Code | 2930909052 |
|---|---|
| Summary | 2930909052 (e)-2-methyl-2-(methylsulfonyl)propanal o-methylcarbamoyl oxime。supervision conditions:s(import or export registration certificate for pesticides)。VAT:17.0%。tax rebate rate:0.0%。MFN tarrif:6.5%。general tariff:30.0% |
|
Determination of pesticides in soy-based infant formula using liquid chromatography with electrospray ionization tandem mass spectrometry.
J. AOAC Int. 89(1) , 214-24, (2006) A sensitive method using liquid chromatography with electrospray ionization tandem mass spectrometry (LC/ESI-MS/MS) was developed and validated to quantify and confirm 13 pesticides, including aldicar... |
|
|
Relationship between esterase activity and acrinathrin and methiocarb resistance in field populations of western flower thrips, Frankliniella occidentalis.
Pest Manag. Sci. 62(12) , 1129-37, (2006) The western flower thrips, Frankliniella occidentalis (Pergande), is a serious pest in the south-east of Spain owing to its direct feeding on crops, transmission of the tomato spotted wilt virus and i... |
|
|
Esterase isoenzymes and insecticide resistance in Frankliniella occidentalis populations from the south-east region of Spain.
Pest Manag. Sci. 64(12) , 1258-66, (2008) Frankliniella occidentalis (Pergande) is among the most important crop pests in the south-east region of Spain; its increasing resistance to insecticides constitutes a serious problem, and understandi... |
| 3,5-dimethyl-4-methylthio-phenyl N-methyl-carbamate |
| 3,5-dimethyl-4-(methylthio)phenyl methylcarbamate |
| EINECS 217-991-2 |
| Mesurol Phenol |
| (3,5-dimethyl-4-methylsulfanylphenyl) N-methylcarbamate |
| Certan |
| Draza |
| 4-methylthio-3,5-xylyl methylcarbamate |
| Methanol, 1-[3,5-dimethyl-4-(methylthio)phenoxy]-1-(methylimino)-, (E)- |
| Phenol, 3,5-dimethyl-4-(methylthio)-, methylcarbamate |
| Mesurol |
| 3,5-Dimethyl-4-(methylsulfanyl)phenyl hydrogen methylcarbonimidate |
| 3,5-dimethyl-4-(methylthio)phenyl N-methylcarbamate |
| Lizetan |
| MFCD00055450 |
| METHIOCARB |
| 4-(methylthio)-3,5-xylyl methylcarbamate |
| Grandslam |
| Mercaptodimethur |
| Methiocarbe |
| Metmercapturon |
| 3,5-Dimethyl-4-(methylsulfanyl)phenyl methylcarbamate |