PF 04449913 maleate
Modify Date: 2025-08-25 10:34:41
PF 04449913 maleate structure
|
Common Name | PF 04449913 maleate | ||
|---|---|---|---|---|
| CAS Number | 2030410-25-2 | Molecular Weight | 490.511 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C25H26N6O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of PF 04449913 maleateGlasdegib Maleate is a potent and orally bioavailable inhibitor of smoothened. |
| Name | MFCD29037212 |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C25H26N6O5 |
|---|---|
| Molecular Weight | 490.511 |
| Exact Mass | 490.196472 |
| InChIKey | VJCVKWFBWAVYOC-UIXXXISESA-N |
| SMILES | CN1CCC(NC(=O)Nc2ccc(C#N)cc2)CC1c1nc2ccccc2[nH]1.O=C(O)C=CC(=O)O |
| 1-[(2R,4R)-2-(1H-Benzimidazol-2-yl)-1-methyl-4-piperidinyl]-3-(4-cyanophenyl)urea (2Z)-2-butenedioate (1:1) |
| Glasdegib maleate salt |
| PF-04449913 maleate salt |
| Urea, N-[(2R,4R)-2-(1H-benzimidazol-2-yl)-1-methyl-4-piperidinyl]-N'-(4-cyanophenyl)-, (2Z)-2-butenedioate (1:1) |
| 1-((2R,4R)-2-(1H-benzo[d]imidazol-2-yl)-1-methylpiperidin-4-yl)-3-(4-cyanophenyl)urea maleate salt |
| MFCD29037212 |