1,3,7-Trihydroxy-2-prenylxanthone structure
|
Common Name | 1,3,7-Trihydroxy-2-prenylxanthone | ||
|---|---|---|---|---|
| CAS Number | 20245-39-0 | Molecular Weight | 312.317 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 576.2±39.0 °C at 760 mmHg | |
| Molecular Formula | C18H16O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 214.5±20.6 °C | |
Use of 1,3,7-Trihydroxy-2-prenylxanthone1,3,7-Trihydroxy-2-prenylxanthone, a xanthone, shows weaker antibacterial activity. 1,3,7-Trihydroxy-2-prenylxanthone exhibits the MIC value of 6.25 mg/ml against VREs strains (E. faecalis, E. faecium, and E. gallinarum)[1]. |
| Name | 1,3,7-Trihydroxy-2-(3-methyl-2-buten-1-yl)-9H-xanthen-9-one |
|---|---|
| Synonym | More Synonyms |
| Description | 1,3,7-Trihydroxy-2-prenylxanthone, a xanthone, shows weaker antibacterial activity. 1,3,7-Trihydroxy-2-prenylxanthone exhibits the MIC value of 6.25 mg/ml against VREs strains (E. faecalis, E. faecium, and E. gallinarum)[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 576.2±39.0 °C at 760 mmHg |
| Molecular Formula | C18H16O5 |
| Molecular Weight | 312.317 |
| Flash Point | 214.5±20.6 °C |
| Exact Mass | 312.099762 |
| PSA | 90.90000 |
| LogP | 3.47 |
| Vapour Pressure | 0.0±1.7 mmHg at 25°C |
| Index of Refraction | 1.676 |
| InChIKey | FLWKTILHZPCXDW-UHFFFAOYSA-N |
| SMILES | CC(C)=CCc1c(O)cc2oc3ccc(O)cc3c(=O)c2c1O |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2932999099 |
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1,3,7-Trihydroxy-2-(3-methyl-2-buten-1-yl)-9H-xanthen-9-one |
| 1,3,7-trichloro-naphthalene |
| 1,3,7-Triaethyl-3,7-dihydro-purin-2,6-dion |
| 1,3,7-Trichlor-naphthalin |
| 2,6,8-Trichlor-naphthalin |
| 1,3,7-triethyl xanthine |
| 1,3,7-trichloronaphtalene |
| PCN 21 |
| 1,3,7-trihydroxy-2-prenylxanthone |
| 1,3,7-Triaethylxanthin |
| 9H-Xanthen-9-one, 1,3,7-trihydroxy-2-(3-methyl-2-butenyl)- |
| Naphthalene,1,3,7-trichloro |
| 1,3,7-triethyl-3,7-dihydro-purine-2,6-dione |
| 1,3,7-trihydroxy-2-isoprenylxanthone |
| 9H-Xanthen-9-one, 1,3,7-trihydroxy-2-(3-methyl-2-buten-1-yl)- |