N33-TEG-COOH structure
|
Common Name | N33-TEG-COOH | ||
|---|---|---|---|---|
| CAS Number | 201467-81-4 | Molecular Weight | 277.27400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H19N3O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | -27.4 °F | |
| Symbol |
GHS02, GHS07 |
Signal Word | Danger | |
Use of N33-TEG-COOHN33-TEG-COOH is a PROTAC linker containing four polyethylene glycol (PEG) units. |
| Name | N3-Teg-COOH |
|---|---|
| Synonym | More Synonyms |
| Description | N33-TEG-COOH is a PROTAC linker containing four polyethylene glycol (PEG) units. |
|---|---|
| Related Catalog | |
| Target |
PROTAC linker[1] |
| In Vitro | N33-TEG-COOH is a long linker extracted from Reference PMID: 26035625, Compound 7. A PROTAC is a heterobifunctional compound that contains two ligands connected by a linker unit. One ligand binds an E3 ubiquitin ligase protein, while the other ligand binds to the target protein of interest, thereby bringing the ligase and the target in close proximity[1]. |
| References |
| Molecular Formula | C10H19N3O6 |
|---|---|
| Molecular Weight | 277.27400 |
| Exact Mass | 277.12700 |
| PSA | 123.97000 |
| InChIKey | YHTABJLSZLHRFV-UHFFFAOYSA-N |
| SMILES | [N-]=[N+]=NCCOCCOCCOCCOCC(=O)O |
| Storage condition | 2-8℃ |
| Symbol |
GHS02, GHS07 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H225-H315 |
| Precautionary Statements | P210 |
| RIDADR | UN 2398 3 / PGII |
| Flash Point(F) | -27.4 °F |
| Flash Point(C) | -33 °C |
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| 2-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethoxy]ethanoic acid |
| N33-TEG-COOH |