N3-TOTA-Suc structure
|
Common Name | N3-TOTA-Suc | ||
|---|---|---|---|---|
| CAS Number | 1993176-74-1 | Molecular Weight | 346.38 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H26N4O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of N3-TOTA-SucN3-TOTA-Suc is a click chemistry reagent containing an azide group. Click chemistry is a powerful chemical reaction with excellent bioorthogonality features: biocompatible, rapid and highly specific in biological environments[1]. |
| Name | N3-TOTA-Suc |
|---|
| Description | N3-TOTA-Suc is a click chemistry reagent containing an azide group. Click chemistry is a powerful chemical reaction with excellent bioorthogonality features: biocompatible, rapid and highly specific in biological environments[1]. |
|---|---|
| Related Catalog |
| Molecular Formula | C14H26N4O6 |
|---|---|
| Molecular Weight | 346.38 |
| InChIKey | MXIOIMFVCMTCGP-UHFFFAOYSA-N |
| SMILES | [N-]=[N+]=NCCCOCCOCCOCCCNC(=O)CCC(=O)O |