N-(4-benzoylphenyl)benzamide structure
|
Common Name | N-(4-benzoylphenyl)benzamide | ||
|---|---|---|---|---|
| CAS Number | 19617-84-6 | Molecular Weight | 301.33900 | |
| Density | 1.222g/cm3 | Boiling Point | 406ºC at 760 mmHg | |
| Molecular Formula | C20H15NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 134.6ºC | |
| Name | N-(4-benzoylphenyl)benzamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.222g/cm3 |
|---|---|
| Boiling Point | 406ºC at 760 mmHg |
| Molecular Formula | C20H15NO2 |
| Molecular Weight | 301.33900 |
| Flash Point | 134.6ºC |
| Exact Mass | 301.11000 |
| PSA | 46.17000 |
| LogP | 4.24290 |
| Vapour Pressure | 8.38E-07mmHg at 25°C |
| Index of Refraction | 1.656 |
| InChIKey | WRYFTNYOWKAAGV-UHFFFAOYSA-N |
| SMILES | O=C(Nc1ccc(C(=O)c2ccccc2)cc1)c1ccccc1 |
| HS Code | 2924299090 |
|---|
| Precursor 8 | |
|---|---|
| DownStream 4 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 4-Benzamino-benzophenon |
| 4'-Benzoylbenzanilide |
| 4-Benzamido-benzophenon |
| 4-Benzoylamino-benzophenon |