1-(6-acetyl-4-chloropyridin-2-yl)ethanone structure
|
Common Name | 1-(6-acetyl-4-chloropyridin-2-yl)ethanone | ||
|---|---|---|---|---|
| CAS Number | 195967-10-3 | Molecular Weight | 197.61800 | |
| Density | 1.253g/cm3 | Boiling Point | 339.6ºC at 760mmHg | |
| Molecular Formula | C9H8ClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 159.2ºC | |
| Name | 1-(6-acetyl-4-chloropyridin-2-yl)ethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.253g/cm3 |
|---|---|
| Boiling Point | 339.6ºC at 760mmHg |
| Molecular Formula | C9H8ClNO2 |
| Molecular Weight | 197.61800 |
| Flash Point | 159.2ºC |
| Exact Mass | 197.02400 |
| PSA | 47.03000 |
| LogP | 2.14020 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.538 |
| InChIKey | HVWKKCHGZJFEQD-UHFFFAOYSA-N |
| SMILES | CC(=O)c1cc(Cl)cc(C(C)=O)n1 |
| HS Code | 2933399090 |
|---|
| Precursor 9 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2,6-diacetyl-4-chloropyridine |
| 4-Chloro-2,6-diacetylpyridine |
| Ethanone,1,1'-(4-chloro-2,6-pyridinediyl)bis |