3,5-bis-(4-Aminophenoxy)benzoic acid structure
|
Common Name | 3,5-bis-(4-Aminophenoxy)benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 195189-45-8 | Molecular Weight | 336.34100 | |
| Density | 1.357g/cm3 | Boiling Point | 583.2ºC at 760 mmHg | |
| Molecular Formula | C19H16N2O4 | Melting Point | 240ºC | |
| MSDS | N/A | Flash Point | 306.5ºC | |
| Name | 3,5-Bis(4-aminophenoxy)benzoic Acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.357g/cm3 |
|---|---|
| Boiling Point | 583.2ºC at 760 mmHg |
| Melting Point | 240ºC |
| Molecular Formula | C19H16N2O4 |
| Molecular Weight | 336.34100 |
| Flash Point | 306.5ºC |
| Exact Mass | 336.11100 |
| PSA | 107.80000 |
| LogP | 5.29620 |
| Vapour Pressure | 1.92E-14mmHg at 25°C |
| Index of Refraction | 1.688 |
| InChIKey | KPKOSOUTWDOOIW-UHFFFAOYSA-N |
| SMILES | Nc1ccc(Oc2cc(Oc3ccc(N)cc3)cc(C(=O)O)c2)cc1 |
| HS Code | 2922509090 |
|---|
|
~85%
3,5-bis-(4-Amin... CAS#:195189-45-8 |
| Literature: Baek, Jong-Beom; Ferguson, John B.; Tan, Loon-Seng Macromolecules, 2003 , vol. 36, # 12 p. 4385 - 4396 |
|
~%
3,5-bis-(4-Amin... CAS#:195189-45-8 |
| Literature: Macromolecules, , vol. 36, # 12 p. 4385 - 4396 |
|
~%
3,5-bis-(4-Amin... CAS#:195189-45-8 |
| Literature: Macromolecules, , vol. 36, # 12 p. 4385 - 4396 |
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| MFCD02093443 |
| 3,5-Bis(4-aMinophenoxy)benzoic Acid |